C10H18N2O — CID 102649989
[cyclobutyl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine (PubChem CID 102649989) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is [cyclobutyl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine.
| Compound Name | [cyclobutyl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 102649989 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | [cyclobutyl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine |
| SMILES | NNC(C1=CCCCO1)C1CCC1 |
| InChI | InChI=1S/C10H18N2O/c11-12-10(8-4-3-5-8)9-6-1-2-7-13-9/h6,8,10,12H,1-5,7,11H2 |
| InChIKey | LRXZLQAIVGGWDV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|