C9H14F2N2O — CID 131181772
[(3,3-difluorocyclobutyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine (PubChem CID 131181772) has the molecular formula C9H14F2N2O and a molecular weight of 204.22 g/mol. Its IUPAC name is [(3,3-difluorocyclobutyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine.
| Compound Name | [(3,3-difluorocyclobutyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 131181772 |
| Molecular Formula | C9H14F2N2O |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | [(3,3-difluorocyclobutyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine |
| SMILES | NNC(C1=CCCO1)C1CC(F)(F)C1 |
| InChI | InChI=1S/C9H14F2N2O/c10-9(11)4-6(5-9)8(13-12)7-2-1-3-14-7/h2,6,8,13H,1,3-5,12H2 |
| InChIKey | IALPVOMEKZASMT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|