C9H16N2O — CID 102654271
[2-cyclopropyl-1-(2,3-dihydrofuran-5-yl)ethyl]hydrazine (PubChem CID 102654271) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is [2-cyclopropyl-1-(2,3-dihydrofuran-5-yl)ethyl]hydrazine.
| Compound Name | [2-cyclopropyl-1-(2,3-dihydrofuran-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 102654271 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | [2-cyclopropyl-1-(2,3-dihydrofuran-5-yl)ethyl]hydrazine |
| SMILES | NNC(CC1CC1)C1=CCCO1 |
| InChI | InChI=1S/C9H16N2O/c10-11-8(6-7-3-4-7)9-2-1-5-12-9/h2,7-8,11H,1,3-6,10H2 |
| InChIKey | OFBFAFOISRXVBS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|