C13H24N2O — CID 102649935
[3,4-dihydro-2H-pyran-6-yl-(3-methylcyclohexyl)methyl]hydrazine (PubChem CID 102649935) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is [3,4-dihydro-2H-pyran-6-yl-(3-methylcyclohexyl)methyl]hydrazine.
| Compound Name | [3,4-dihydro-2H-pyran-6-yl-(3-methylcyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 102649935 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | [3,4-dihydro-2H-pyran-6-yl-(3-methylcyclohexyl)methyl]hydrazine |
| SMILES | CC1CCCC(C(NN)C2=CCCCO2)C1 |
| InChI | InChI=1S/C13H24N2O/c1-10-5-4-6-11(9-10)13(15-14)12-7-2-3-8-16-12/h7,10-11,13,15H,2-6,8-9,14H2,1H3 |
| InChIKey | SUCQHVQIZSXWBC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|