C13H26N2O — CID 102650280
1-(3,4-dihydro-2H-pyran-6-yl)octylhydrazine (PubChem CID 102650280) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)octylhydrazine.
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)octylhydrazine |
|---|---|
| PubChem CID | 102650280 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)octylhydrazine |
| SMILES | CCCCCCCC(NN)C1=CCCCO1 |
| InChI | InChI=1S/C13H26N2O/c1-2-3-4-5-6-9-12(15-14)13-10-7-8-11-16-13/h10,12,15H,2-9,11,14H2,1H3 |
| InChIKey | IUMSLAIOYJLNDJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|