C12H24N2O — CID 102650283
1-(3,4-dihydro-2H-pyran-6-yl)heptylhydrazine (PubChem CID 102650283) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)heptylhydrazine.
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)heptylhydrazine |
|---|---|
| PubChem CID | 102650283 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)heptylhydrazine |
| SMILES | CCCCCCC(NN)C1=CCCCO1 |
| InChI | InChI=1S/C12H24N2O/c1-2-3-4-5-8-11(14-13)12-9-6-7-10-15-12/h9,11,14H,2-8,10,13H2,1H3 |
| InChIKey | BUJHOOUNEYQRAT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|