C12H13BrO2 — CID 102650455
1-(4-bromophenyl)-1-(2,3-dihydrofuran-5-yl)ethanol (PubChem CID 102650455) has the molecular formula C12H13BrO2 and a molecular weight of 269.14 g/mol. Its IUPAC name is 1-(4-bromophenyl)-1-(2,3-dihydrofuran-5-yl)ethanol.
| Compound Name | 1-(4-bromophenyl)-1-(2,3-dihydrofuran-5-yl)ethanol |
|---|---|
| PubChem CID | 102650455 |
| Molecular Formula | C12H13BrO2 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 1-(4-bromophenyl)-1-(2,3-dihydrofuran-5-yl)ethanol |
| SMILES | CC(O)(C1=CCCO1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H13BrO2/c1-12(14,11-3-2-8-15-11)9-4-6-10(13)7-5-9/h3-7,14H,2,8H2,1H3 |
| InChIKey | PMGOUUFHUXSZAY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |