C13H7N3O2S — CID 10265071
13-methyl-14-oxa-17-thia-2,9,12-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-15-one (PubChem CID 10265071) has the molecular formula C13H7N3O2S and a molecular weight of 269.29 g/mol. Its IUPAC name is 13-methyl-14-oxa-17-thia-2,9,12-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-15-one.
| Compound Name | 13-methyl-14-oxa-17-thia-2,9,12-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-15-one |
|---|---|
| PubChem CID | 10265071 |
| Molecular Formula | C13H7N3O2S |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 13-methyl-14-oxa-17-thia-2,9,12-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-15-one |
| SMILES | Cc1nc2c(sc3nc4ccccc4nc32)c(=O)o1 |
| InChI | InChI=1S/C13H7N3O2S/c1-6-14-9-10-12(19-11(9)13(17)18-6)16-8-5-3-2-4-7(8)15-10/h2-5H,1H3 |
| InChIKey | LSBKNLODVILBCX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |