C9H14FNO — CID 102652365
4-(2,3-dihydrofuran-5-yl)-4-fluoropiperidine (PubChem CID 102652365) has the molecular formula C9H14FNO and a molecular weight of 171.21 g/mol. Its IUPAC name is 4-(2,3-dihydrofuran-5-yl)-4-fluoropiperidine.
| Compound Name | 4-(2,3-dihydrofuran-5-yl)-4-fluoropiperidine |
|---|---|
| PubChem CID | 102652365 |
| Molecular Formula | C9H14FNO |
| Molecular Weight | 171.21 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 4-(2,3-dihydrofuran-5-yl)-4-fluoropiperidine |
| SMILES | FC1(C2=CCCO2)CCNCC1 |
| InChI | InChI=1S/C9H14FNO/c10-9(3-5-11-6-4-9)8-2-1-7-12-8/h2,11H,1,3-7H2 |
| InChIKey | WPKQTCPRIYFDEW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |