C8H13NO3 — CID 102652546
2-(2-aminoethoxy)-1-(2,3-dihydrofuran-5-yl)ethanone (PubChem CID 102652546) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-1-(2,3-dihydrofuran-5-yl)ethanone.
| Compound Name | 2-(2-aminoethoxy)-1-(2,3-dihydrofuran-5-yl)ethanone |
|---|---|
| PubChem CID | 102652546 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 2-(2-aminoethoxy)-1-(2,3-dihydrofuran-5-yl)ethanone |
| SMILES | NCCOCC(=O)C1=CCCO1 |
| InChI | InChI=1S/C8H13NO3/c9-3-5-11-6-7(10)8-2-1-4-12-8/h2H,1,3-6,9H2 |
| InChIKey | MVGWCVPOOWZNIO-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|