C10H17NO2 — CID 102652608
3-amino-1-(2,3-dihydrofuran-5-yl)hexan-1-one (PubChem CID 102652608) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 3-amino-1-(2,3-dihydrofuran-5-yl)hexan-1-one.
| Compound Name | 3-amino-1-(2,3-dihydrofuran-5-yl)hexan-1-one |
|---|---|
| PubChem CID | 102652608 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 3-amino-1-(2,3-dihydrofuran-5-yl)hexan-1-one |
| SMILES | CCCC(N)CC(=O)C1=CCCO1 |
| InChI | InChI=1S/C10H17NO2/c1-2-4-8(11)7-9(12)10-5-3-6-13-10/h5,8H,2-4,6-7,11H2,1H3 |
| InChIKey | SAMYTPJIWZJINN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |