C14H26OS2 — CID 10265384
(2S,3R)-1-(1,3-dithian-2-ylidene)-2-methylnonan-3-ol (PubChem CID 10265384) has the molecular formula C14H26OS2 and a molecular weight of 274.49 g/mol. Its IUPAC name is (2S,3R)-1-(1,3-dithian-2-ylidene)-2-methylnonan-3-ol.
| Compound Name | (2S,3R)-1-(1,3-dithian-2-ylidene)-2-methylnonan-3-ol |
|---|---|
| PubChem CID | 10265384 |
| Molecular Formula | C14H26OS2 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (2S,3R)-1-(1,3-dithian-2-ylidene)-2-methylnonan-3-ol |
| SMILES | CCCCCC[C@@H](O)[C@@H](C)C=C1SCCCS1 |
| InChI | InChI=1S/C14H26OS2/c1-3-4-5-6-8-13(15)12(2)11-14-16-9-7-10-17-14/h11-13,15H,3-10H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | MUMNZIIOESTVRH-QWHCGFSZSA-N |
| XLogP | 4.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|