C6H12N2O — CID 102654075
1-(2,3-dihydrofuran-5-yl)ethylhydrazine (PubChem CID 102654075) has the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-5-yl)ethylhydrazine.
| Compound Name | 1-(2,3-dihydrofuran-5-yl)ethylhydrazine |
|---|---|
| PubChem CID | 102654075 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 1-(2,3-dihydrofuran-5-yl)ethylhydrazine |
| SMILES | CC(NN)C1=CCCO1 |
| InChI | InChI=1S/C6H12N2O/c1-5(8-7)6-3-2-4-9-6/h3,5,8H,2,4,7H2,1H3 |
| InChIKey | VZUYJVKAKXUFFO-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|