C8H16N2O — CID 102654078
1-(2,3-dihydrofuran-5-yl)butylhydrazine (PubChem CID 102654078) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-5-yl)butylhydrazine.
| Compound Name | 1-(2,3-dihydrofuran-5-yl)butylhydrazine |
|---|---|
| PubChem CID | 102654078 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 1-(2,3-dihydrofuran-5-yl)butylhydrazine |
| SMILES | CCCC(NN)C1=CCCO1 |
| InChI | InChI=1S/C8H16N2O/c1-2-4-7(10-9)8-5-3-6-11-8/h5,7,10H,2-4,6,9H2,1H3 |
| InChIKey | YSJBGPGAILZJHI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|