C18H22O3 — CID 10266010
8-[(E)-1-phenylbut-1-enyl]-1,4-dioxaspiro[4.5]decan-7-one (PubChem CID 10266010) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is 8-[(E)-1-phenylbut-1-enyl]-1,4-dioxaspiro[4.5]decan-7-one.
| Compound Name | 8-[(E)-1-phenylbut-1-enyl]-1,4-dioxaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 10266010 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 8-[(E)-1-phenylbut-1-enyl]-1,4-dioxaspiro[4.5]decan-7-one |
| SMILES | CC/C=C(/c1ccccc1)C1CCC2(CC1=O)OCCO2 |
| InChI | InChI=1S/C18H22O3/c1-2-6-15(14-7-4-3-5-8-14)16-9-10-18(13-17(16)19)20-11-12-21-18/h3-8,16H,2,9-13H2,1H3/b15-6- |
| InChIKey | INGXQFULJAYZBM-UUASQNMZSA-N |
| XLogP | 3.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |