C10H8FN3O4 — CID 102660611
1-[5-(4-fluoro-2-nitrophenyl)-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 102660611) has the molecular formula C10H8FN3O4 and a molecular weight of 253.19 g/mol. Its IUPAC name is 1-[5-(4-fluoro-2-nitrophenyl)-1,2,4-oxadiazol-3-yl]ethanol.
| Compound Name | 1-[5-(4-fluoro-2-nitrophenyl)-1,2,4-oxadiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 102660611 |
| Molecular Formula | C10H8FN3O4 |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 1-[5-(4-fluoro-2-nitrophenyl)-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | CC(O)c1noc(-c2ccc(F)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C10H8FN3O4/c1-5(15)9-12-10(18-13-9)7-3-2-6(11)4-8(7)14(16)17/h2-5,15H,1H3 |
| InChIKey | RXZOGZHBPIEVAU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|