C14H21NO3S — CID 102671014
2-methyl-N-(3,4,5-trimethoxyphenyl)thiolan-3-amine (PubChem CID 102671014) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 2-methyl-N-(3,4,5-trimethoxyphenyl)thiolan-3-amine.
| Compound Name | 2-methyl-N-(3,4,5-trimethoxyphenyl)thiolan-3-amine |
|---|---|
| PubChem CID | 102671014 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-methyl-N-(3,4,5-trimethoxyphenyl)thiolan-3-amine |
| SMILES | COc1cc(NC2CCSC2C)cc(OC)c1OC |
| InChI | InChI=1S/C14H21NO3S/c1-9-11(5-6-19-9)15-10-7-12(16-2)14(18-4)13(8-10)17-3/h7-9,11,15H,5-6H2,1-4H3 |
| InChIKey | WHQQQKFLVAIZTR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|