C17H13N3O3 — CID 10267208
1-(4-nitrophenyl)-4,5-dihydro-[1]benzoxepino[4,5-d]pyrazole (PubChem CID 10267208) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-4,5-dihydro-[1]benzoxepino[4,5-d]pyrazole.
| Compound Name | 1-(4-nitrophenyl)-4,5-dihydro-[1]benzoxepino[4,5-d]pyrazole |
|---|---|
| PubChem CID | 10267208 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 1-(4-nitrophenyl)-4,5-dihydro-[1]benzoxepino[4,5-d]pyrazole |
| SMILES | O=[N+]([O-])c1ccc(-n2ncc3c2-c2ccccc2OCC3)cc1 |
| InChI | InChI=1S/C17H13N3O3/c21-20(22)14-7-5-13(6-8-14)19-17-12(11-18-19)9-10-23-16-4-2-1-3-15(16)17/h1-8,11H,9-10H2 |
| InChIKey | CHCNXRQASMEJQW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|