C15H19NOS2 — CID 102672384
N-(dithiophen-2-ylmethyl)-2-(oxolan-3-yl)ethanamine (PubChem CID 102672384) has the molecular formula C15H19NOS2 and a molecular weight of 293.46 g/mol. Its IUPAC name is N-(dithiophen-2-ylmethyl)-2-(oxolan-3-yl)ethanamine.
| Compound Name | N-(dithiophen-2-ylmethyl)-2-(oxolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 102672384 |
| Molecular Formula | C15H19NOS2 |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | N-(dithiophen-2-ylmethyl)-2-(oxolan-3-yl)ethanamine |
| SMILES | c1csc(C(NCCC2CCOC2)c2cccs2)c1 |
| InChI | InChI=1S/C15H19NOS2/c1-3-13(18-9-1)15(14-4-2-10-19-14)16-7-5-12-6-8-17-11-12/h1-4,9-10,12,15-16H,5-8,11H2 |
| InChIKey | GZTAIIROLOSOTE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |