C10H14ClNOS — CID 130643756
2-chloro-N-[2-(oxolan-3-yl)ethyl]thiophen-3-amine (PubChem CID 130643756) has the molecular formula C10H14ClNOS and a molecular weight of 231.75 g/mol. Its IUPAC name is 2-chloro-N-[2-(oxolan-3-yl)ethyl]thiophen-3-amine.
| Compound Name | 2-chloro-N-[2-(oxolan-3-yl)ethyl]thiophen-3-amine |
|---|---|
| PubChem CID | 130643756 |
| Molecular Formula | C10H14ClNOS |
| Molecular Weight | 231.75 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2-chloro-N-[2-(oxolan-3-yl)ethyl]thiophen-3-amine |
| SMILES | Clc1sccc1NCCC1CCOC1 |
| InChI | InChI=1S/C10H14ClNOS/c11-10-9(3-6-14-10)12-4-1-8-2-5-13-7-8/h3,6,8,12H,1-2,4-5,7H2 |
| InChIKey | GKNBDQLRGHFSBD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.75 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |