C10H15ClN2OS — CID 104879629
N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(oxolan-3-yl)ethanamine (PubChem CID 104879629) has the molecular formula C10H15ClN2OS and a molecular weight of 246.76 g/mol. Its IUPAC name is N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(oxolan-3-yl)ethanamine.
| Compound Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(oxolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 104879629 |
| Molecular Formula | C10H15ClN2OS |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(oxolan-3-yl)ethanamine |
| SMILES | Clc1cnc(CNCCC2CCOC2)s1 |
| InChI | InChI=1S/C10H15ClN2OS/c11-9-5-13-10(15-9)6-12-3-1-8-2-4-14-7-8/h5,8,12H,1-4,6-7H2 |
| InChIKey | HPSFFVACRUTZLI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|