C7H8ClNOS — CID 117259060
5-chloro-2-(oxolan-3-yl)-1,3-thiazole (PubChem CID 117259060) has the molecular formula C7H8ClNOS and a molecular weight of 189.67 g/mol. Its IUPAC name is 5-chloro-2-(oxolan-3-yl)-1,3-thiazole.
| Compound Name | 5-chloro-2-(oxolan-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 117259060 |
| Molecular Formula | C7H8ClNOS |
| Molecular Weight | 189.67 g/mol |
| Exact Mass | 189.00 |
| IUPAC Name | 5-chloro-2-(oxolan-3-yl)-1,3-thiazole |
| SMILES | Clc1cnc(C2CCOC2)s1 |
| InChI | InChI=1S/C7H8ClNOS/c8-6-3-9-7(11-6)5-1-2-10-4-5/h3,5H,1-2,4H2 |
| InChIKey | WNCDCOSVABKAJI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.67 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |