C7H10N2OS — CID 124595055
5-[(3R)-oxolan-3-yl]-1,3-thiazol-2-amine (PubChem CID 124595055) has the molecular formula C7H10N2OS and a molecular weight of 170.24 g/mol. Its IUPAC name is 5-[(3R)-oxolan-3-yl]-1,3-thiazol-2-amine.
| Compound Name | 5-[(3R)-oxolan-3-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 124595055 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 5-[(3R)-oxolan-3-yl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc([C@@H]2CCOC2)s1 |
| InChI | InChI=1S/C7H10N2OS/c8-7-9-3-6(11-7)5-1-2-10-4-5/h3,5H,1-2,4H2,(H2,8,9)/t5-/m1/s1 |
| InChIKey | NFTULFIVZBPYCL-RXMQYKEDSA-N |
| XLogP | 1.23 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |