C10H16N2OS — CID 130664722
5-[2-(oxan-4-yl)ethyl]-1,3-thiazol-2-amine (PubChem CID 130664722) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 5-[2-(oxan-4-yl)ethyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[2-(oxan-4-yl)ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 130664722 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 5-[2-(oxan-4-yl)ethyl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(CCC2CCOCC2)s1 |
| InChI | InChI=1S/C10H16N2OS/c11-10-12-7-9(14-10)2-1-8-3-5-13-6-4-8/h7-8H,1-6H2,(H2,11,12) |
| InChIKey | HYIVMKSPPGHMMC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |