C11H18N4O — CID 66699694
5-[2-(oxan-4-yl)ethyl]pyrazine-2,3-diamine (PubChem CID 66699694) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 5-[2-(oxan-4-yl)ethyl]pyrazine-2,3-diamine.
| Compound Name | 5-[2-(oxan-4-yl)ethyl]pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 66699694 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 5-[2-(oxan-4-yl)ethyl]pyrazine-2,3-diamine |
| SMILES | Nc1ncc(CCC2CCOCC2)nc1N |
| InChI | InChI=1S/C11H18N4O/c12-10-11(13)15-9(7-14-10)2-1-8-3-5-16-6-4-8/h7-8H,1-6H2,(H2,12,14)(H2,13,15) |
| InChIKey | NLSKPJCJQNGDGJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |