C11H13NOS — CID 167203629
2-(oxolan-3-yl)-6,7-dihydro-1,3-benzothiazole (PubChem CID 167203629) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is 2-(oxolan-3-yl)-6,7-dihydro-1,3-benzothiazole.
| Compound Name | 2-(oxolan-3-yl)-6,7-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 167203629 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 2-(oxolan-3-yl)-6,7-dihydro-1,3-benzothiazole |
| SMILES | C1=Cc2nc(C3CCOC3)sc2CC1 |
| InChI | InChI=1S/C11H13NOS/c1-2-4-10-9(3-1)12-11(14-10)8-5-6-13-7-8/h1,3,8H,2,4-7H2 |
| InChIKey | SHFJBBRQHKRXFW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |