C14H27N3O2S — CID 102672860
tert-butyl 3-(2-thiomorpholin-4-ylethylamino)azetidine-1-carboxylate (PubChem CID 102672860) has the molecular formula C14H27N3O2S and a molecular weight of 301.46 g/mol. Its IUPAC name is tert-butyl 3-(2-thiomorpholin-4-ylethylamino)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-thiomorpholin-4-ylethylamino)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 102672860 |
| Molecular Formula | C14H27N3O2S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | tert-butyl 3-(2-thiomorpholin-4-ylethylamino)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(NCCN2CCSCC2)C1 |
| InChI | InChI=1S/C14H27N3O2S/c1-14(2,3)19-13(18)17-10-12(11-17)15-4-5-16-6-8-20-9-7-16/h12,15H,4-11H2,1-3H3 |
| InChIKey | LNSQBIYMZQXTHB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |