C9H21NO2S — CID 102672962
N-(2-ethylsulfanylethyl)-2,3-dimethoxypropan-1-amine (PubChem CID 102672962) has the molecular formula C9H21NO2S and a molecular weight of 207.34 g/mol. Its IUPAC name is N-(2-ethylsulfanylethyl)-2,3-dimethoxypropan-1-amine.
| Compound Name | N-(2-ethylsulfanylethyl)-2,3-dimethoxypropan-1-amine |
|---|---|
| PubChem CID | 102672962 |
| Molecular Formula | C9H21NO2S |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-(2-ethylsulfanylethyl)-2,3-dimethoxypropan-1-amine |
| SMILES | CCSCCNCC(COC)OC |
| InChI | InChI=1S/C9H21NO2S/c1-4-13-6-5-10-7-9(12-3)8-11-2/h9-10H,4-8H2,1-3H3 |
| InChIKey | POQFXTWWVSYFBG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|