C18H16OS2 — CID 10267545
(1Z,4Z)-1-methylsulfanyl-1,5-diphenyl-5-sulfanylpenta-1,4-dien-3-one (PubChem CID 10267545) has the molecular formula C18H16OS2 and a molecular weight of 312.46 g/mol. Its IUPAC name is (1Z,4Z)-1-methylsulfanyl-1,5-diphenyl-5-sulfanylpenta-1,4-dien-3-one.
| Compound Name | (1Z,4Z)-1-methylsulfanyl-1,5-diphenyl-5-sulfanylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 10267545 |
| Molecular Formula | C18H16OS2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (1Z,4Z)-1-methylsulfanyl-1,5-diphenyl-5-sulfanylpenta-1,4-dien-3-one |
| SMILES | CS/C(=C\C(=O)/C=C(\S)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H16OS2/c1-21-18(15-10-6-3-7-11-15)13-16(19)12-17(20)14-8-4-2-5-9-14/h2-13,20H,1H3/b17-12-,18-13- |
| InChIKey | VXEAPCQTCDKOEL-MZGHLJKDSA-N |
| XLogP | 4.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|