C15H23NO2S — CID 143017894
(2Z,4Z)-3-amino-5-phenyl-5-sulfanylpenta-2,4-dienoic acid;ethane (PubChem CID 143017894) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is (2Z,4Z)-3-amino-5-phenyl-5-sulfanylpenta-2,4-dienoic acid;ethane.
| Compound Name | (2Z,4Z)-3-amino-5-phenyl-5-sulfanylpenta-2,4-dienoic acid;ethane |
|---|---|
| PubChem CID | 143017894 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (2Z,4Z)-3-amino-5-phenyl-5-sulfanylpenta-2,4-dienoic acid;ethane |
| SMILES | CC.CC.NC(=C\C(=O)O)/C=C(\S)c1ccccc1 |
| InChI | InChI=1S/C11H11NO2S.2C2H6/c12-9(7-11(13)14)6-10(15)8-4-2-1-3-5-8;2*1-2/h1-7,15H,12H2,(H,13,14);2*1-2H3/b9-7-,10-6-;; |
| InChIKey | YHOUPDNHASMJGT-HVCHZIDASA-N |
| XLogP | 3.94 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|