C13H24N2O — CID 102678173
1-[1-(oxolan-3-yl)ethyl]-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 102678173) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-[1-(oxolan-3-yl)ethyl]-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | 1-[1-(oxolan-3-yl)ethyl]-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 102678173 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 1-[1-(oxolan-3-yl)ethyl]-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | CC(C1CCOC1)N1CCCC2CNCC21 |
| InChI | InChI=1S/C13H24N2O/c1-10(12-4-6-16-9-12)15-5-2-3-11-7-14-8-13(11)15/h10-14H,2-9H2,1H3 |
| InChIKey | ONWOZWKRMZLMIN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |