C22H22O2 — CID 10267914
(10R)-6,13-dimethyl-10-prop-2-ynyl-12,14,15,16-tetrahydro-8H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 10267914) has the molecular formula C22H22O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is (10R)-6,13-dimethyl-10-prop-2-ynyl-12,14,15,16-tetrahydro-8H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (10R)-6,13-dimethyl-10-prop-2-ynyl-12,14,15,16-tetrahydro-8H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 10267914 |
| Molecular Formula | C22H22O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (10R)-6,13-dimethyl-10-prop-2-ynyl-12,14,15,16-tetrahydro-8H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C#CC[C@]12C=CC(=O)C=C1C(C)=CC1C2=CCC2(C)C(=O)CCC12 |
| InChI | InChI=1S/C22H22O2/c1-4-9-22-11-7-15(23)13-19(22)14(2)12-16-17-5-6-20(24)21(17,3)10-8-18(16)22/h1,7-8,11-13,16-17H,5-6,9-10H2,2-3H3/t16?,17?,21?,22-/m1/s1 |
| InChIKey | JRWMHUSDTOYDGY-TWQSIKMXSA-N |
| XLogP | 3.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|