C21H22Br2O2 — CID 56610695
(6S,7S,8R,9S,10R,13S,14S)-6,7-dibromo-13-methyl-10-prop-2-ynyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 56610695) has the molecular formula C21H22Br2O2 and a molecular weight of 466.21 g/mol. Its IUPAC name is (6S,7S,8R,9S,10R,13S,14S)-6,7-dibromo-13-methyl-10-prop-2-ynyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (6S,7S,8R,9S,10R,13S,14S)-6,7-dibromo-13-methyl-10-prop-2-ynyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 56610695 |
| Molecular Formula | C21H22Br2O2 |
| Molecular Weight | 466.21 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | (6S,7S,8R,9S,10R,13S,14S)-6,7-dibromo-13-methyl-10-prop-2-ynyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C#CC[C@]12C=CC(=O)C=C1[C@H](Br)[C@@H](Br)[C@H]1[C@@H]3CCC(=O)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C21H22Br2O2/c1-3-8-21-10-6-12(24)11-15(21)18(22)19(23)17-13-4-5-16(25)20(13,2)9-7-14(17)21/h1,6,10-11,13-14,17-19H,4-5,7-9H2,2H3/t13-,14-,17-,18-,19-,20-,21+/m0/s1 |
| InChIKey | TXLDKLWBEFKCBM-AFWRVKQNSA-N |
| XLogP | 4.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.21 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|