C11H13BrN2OS — CID 102685349
3-(3-bromo-2-methylpropyl)-7-methylthieno[3,2-d]pyrimidin-4-one (PubChem CID 102685349) has the molecular formula C11H13BrN2OS and a molecular weight of 301.21 g/mol. Its IUPAC name is 3-(3-bromo-2-methylpropyl)-7-methylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-(3-bromo-2-methylpropyl)-7-methylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 102685349 |
| Molecular Formula | C11H13BrN2OS |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 3-(3-bromo-2-methylpropyl)-7-methylthieno[3,2-d]pyrimidin-4-one |
| SMILES | Cc1csc2c(=O)n(CC(C)CBr)cnc12 |
| InChI | InChI=1S/C11H13BrN2OS/c1-7(3-12)4-14-6-13-9-8(2)5-16-10(9)11(14)15/h5-7H,3-4H2,1-2H3 |
| InChIKey | TVLXMDIQOWWFIH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|