C16H16N2OS2 — CID 102685900
7-methyl-3-(2-phenyl-3-sulfanylpropyl)thieno[3,2-d]pyrimidin-4-one (PubChem CID 102685900) has the molecular formula C16H16N2OS2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 7-methyl-3-(2-phenyl-3-sulfanylpropyl)thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 7-methyl-3-(2-phenyl-3-sulfanylpropyl)thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 102685900 |
| Molecular Formula | C16H16N2OS2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 7-methyl-3-(2-phenyl-3-sulfanylpropyl)thieno[3,2-d]pyrimidin-4-one |
| SMILES | Cc1csc2c(=O)n(CC(CS)c3ccccc3)cnc12 |
| InChI | InChI=1S/C16H16N2OS2/c1-11-9-21-15-14(11)17-10-18(16(15)19)7-13(8-20)12-5-3-2-4-6-12/h2-6,9-10,13,20H,7-8H2,1H3 |
| InChIKey | DSJAKQPOILTWOF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 34.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|