C15H20N2OS2 — CID 102685898
7-methyl-3-[[1-(sulfanylmethyl)cyclohexyl]methyl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 102685898) has the molecular formula C15H20N2OS2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 7-methyl-3-[[1-(sulfanylmethyl)cyclohexyl]methyl]thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 7-methyl-3-[[1-(sulfanylmethyl)cyclohexyl]methyl]thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 102685898 |
| Molecular Formula | C15H20N2OS2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 7-methyl-3-[[1-(sulfanylmethyl)cyclohexyl]methyl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | Cc1csc2c(=O)n(CC3(CS)CCCCC3)cnc12 |
| InChI | InChI=1S/C15H20N2OS2/c1-11-7-20-13-12(11)16-10-17(14(13)18)8-15(9-19)5-3-2-4-6-15/h7,10,19H,2-6,8-9H2,1H3 |
| InChIKey | SPFXWPACYYULPQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 34.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|