2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbenzoic acid

C14H10N2O2S2 — CID 102686148

IUPAC2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbenzoic acid
SMILESCc1csc2c(Sc3ccccc3C(=O)O)ncnc12
InChIInChI=1S/C14H10N2O2S2/c1-8-6-19-12-11(8)15-7-16-13(12)20-10-5-3-2-4-9(10)14(17)18/h2-7H,1H3,(H,17,18)
InChIKeyFSIFVNHAXDAJTF-UHFFFAOYSA-N
MW302.38 g/mol
LogP3.85
Rot. Bonds3

About 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbenzoic acid

2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbenzoic acid (PubChem CID 102686148) has the molecular formula C14H10N2O2S2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbenzoic acid.

Molecular Properties

Compound Name2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbenzoic acid
PubChem CID102686148
Molecular FormulaC14H10N2O2S2
Molecular Weight302.38 g/mol
Exact Mass302.02
IUPAC Name2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbenzoic acid
SMILESCc1csc2c(Sc3ccccc3C(=O)O)ncnc12
InChIInChI=1S/C14H10N2O2S2/c1-8-6-19-12-11(8)15-7-16-13(12)20-10-5-3-2-4-9(10)14(17)18/h2-7H,1H3,(H,17,18)
InChIKeyFSIFVNHAXDAJTF-UHFFFAOYSA-N
XLogP3.85
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.38
LogP ≤ 53.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbenzoic acid?
The IUPAC name of 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbenzoic acid (CID 102686148) is 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbenzoic acid.
What is the SMILES notation for 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbenzoic acid?
The canonical SMILES for 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbenzoic acid is Cc1csc2c(Sc3ccccc3C(=O)O)ncnc12.
What is the InChIKey of 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbenzoic acid?
The InChIKey is FSIFVNHAXDAJTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O2S2/c1-8-6-19-12-11(8)15-7-16-13(12)20-10-5-3-2-4-9(10)14(17)18/h2-7H,1H3,(H,17,18).
What are the key properties of 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbenzoic acid?
2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbenzoic acid has a molecular weight of 302.38 g/mol, XLogP of 3.85, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbenzoic acid is sourced from PubChem (CID 102686148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).