C15H12N2O3S — CID 102687093
2-methyl-3-(7-methylthieno[3,2-d]pyrimidin-4-yl)oxybenzoic acid (PubChem CID 102687093) has the molecular formula C15H12N2O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-methyl-3-(7-methylthieno[3,2-d]pyrimidin-4-yl)oxybenzoic acid.
| Compound Name | 2-methyl-3-(7-methylthieno[3,2-d]pyrimidin-4-yl)oxybenzoic acid |
|---|---|
| PubChem CID | 102687093 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-methyl-3-(7-methylthieno[3,2-d]pyrimidin-4-yl)oxybenzoic acid |
| SMILES | Cc1c(Oc2ncnc3c(C)csc23)cccc1C(=O)O |
| InChI | InChI=1S/C15H12N2O3S/c1-8-6-21-13-12(8)16-7-17-14(13)20-11-5-3-4-10(9(11)2)15(18)19/h3-7H,1-2H3,(H,18,19) |
| InChIKey | QGYUINDNUGNTHC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |