C13H10BrN3OS — CID 102686774
2-bromo-3-(7-methylthieno[3,2-d]pyrimidin-4-yl)oxyaniline (PubChem CID 102686774) has the molecular formula C13H10BrN3OS and a molecular weight of 336.21 g/mol. Its IUPAC name is 2-bromo-3-(7-methylthieno[3,2-d]pyrimidin-4-yl)oxyaniline.
| Compound Name | 2-bromo-3-(7-methylthieno[3,2-d]pyrimidin-4-yl)oxyaniline |
|---|---|
| PubChem CID | 102686774 |
| Molecular Formula | C13H10BrN3OS |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 334.97 |
| IUPAC Name | 2-bromo-3-(7-methylthieno[3,2-d]pyrimidin-4-yl)oxyaniline |
| SMILES | Cc1csc2c(Oc3cccc(N)c3Br)ncnc12 |
| InChI | InChI=1S/C13H10BrN3OS/c1-7-5-19-12-11(7)16-6-17-13(12)18-9-4-2-3-8(15)10(9)14/h2-6H,15H2,1H3 |
| InChIKey | SAEHXUFBMNMMCY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|