C14H10N4OS — CID 102686754
3-amino-4-(7-methylthieno[3,2-d]pyrimidin-4-yl)oxybenzonitrile (PubChem CID 102686754) has the molecular formula C14H10N4OS and a molecular weight of 282.33 g/mol. Its IUPAC name is 3-amino-4-(7-methylthieno[3,2-d]pyrimidin-4-yl)oxybenzonitrile.
| Compound Name | 3-amino-4-(7-methylthieno[3,2-d]pyrimidin-4-yl)oxybenzonitrile |
|---|---|
| PubChem CID | 102686754 |
| Molecular Formula | C14H10N4OS |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 3-amino-4-(7-methylthieno[3,2-d]pyrimidin-4-yl)oxybenzonitrile |
| SMILES | Cc1csc2c(Oc3ccc(C#N)cc3N)ncnc12 |
| InChI | InChI=1S/C14H10N4OS/c1-8-6-20-13-12(8)17-7-18-14(13)19-11-3-2-9(5-15)4-10(11)16/h2-4,6-7H,16H2,1H3 |
| InChIKey | VPRSHJMJPRIVGQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|