C9H17N3O2S — CID 102691010
N-(2-ethylbutyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102691010) has the molecular formula C9H17N3O2S and a molecular weight of 231.32 g/mol. Its IUPAC name is N-(2-ethylbutyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(2-ethylbutyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102691010 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | N-(2-ethylbutyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCC(CC)CNS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C9H17N3O2S/c1-3-8(4-2)7-11-15(13,14)9-5-6-10-12-9/h5-6,8,11H,3-4,7H2,1-2H3,(H,10,12) |
| InChIKey | WNKUCAIPNMDTDE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |