C9H14N4O2S — CID 102691104
N-(3-cyanopentan-3-yl)-1H-pyrazole-5-sulfonamide (PubChem CID 102691104) has the molecular formula C9H14N4O2S and a molecular weight of 242.30 g/mol. Its IUPAC name is N-(3-cyanopentan-3-yl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(3-cyanopentan-3-yl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102691104 |
| Molecular Formula | C9H14N4O2S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | N-(3-cyanopentan-3-yl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCC(C#N)(CC)NS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C9H14N4O2S/c1-3-9(4-2,7-10)13-16(14,15)8-5-6-11-12-8/h5-6,13H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | HYHCQAZMMRSHLA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |