C8H12N4O2S2 — CID 102691214
2-cyclopropyl-2-(1H-pyrazol-5-ylsulfonylamino)ethanethioamide (PubChem CID 102691214) has the molecular formula C8H12N4O2S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-cyclopropyl-2-(1H-pyrazol-5-ylsulfonylamino)ethanethioamide.
| Compound Name | 2-cyclopropyl-2-(1H-pyrazol-5-ylsulfonylamino)ethanethioamide |
|---|---|
| PubChem CID | 102691214 |
| Molecular Formula | C8H12N4O2S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 2-cyclopropyl-2-(1H-pyrazol-5-ylsulfonylamino)ethanethioamide |
| SMILES | NC(=S)C(NS(=O)(=O)c1ccn[nH]1)C1CC1 |
| InChI | InChI=1S/C8H12N4O2S2/c9-8(15)7(5-1-2-5)12-16(13,14)6-3-4-10-11-6/h3-5,7,12H,1-2H2,(H2,9,15)(H,10,11) |
| InChIKey | FZBBSWQYRHAMFC-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|