C10H19N3O2S — CID 102691717
N-(5-methylhexan-2-yl)-1H-pyrazole-5-sulfonamide (PubChem CID 102691717) has the molecular formula C10H19N3O2S and a molecular weight of 245.35 g/mol. Its IUPAC name is N-(5-methylhexan-2-yl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(5-methylhexan-2-yl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102691717 |
| Molecular Formula | C10H19N3O2S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-(5-methylhexan-2-yl)-1H-pyrazole-5-sulfonamide |
| SMILES | CC(C)CCC(C)NS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C10H19N3O2S/c1-8(2)4-5-9(3)13-16(14,15)10-6-7-11-12-10/h6-9,13H,4-5H2,1-3H3,(H,11,12) |
| InChIKey | AYXZSPHCQCZEBA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |