C8H12F3N3O2S — CID 102693247
N-(5,5,5-trifluoropentyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102693247) has the molecular formula C8H12F3N3O2S and a molecular weight of 271.26 g/mol. Its IUPAC name is N-(5,5,5-trifluoropentyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(5,5,5-trifluoropentyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102693247 |
| Molecular Formula | C8H12F3N3O2S |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | N-(5,5,5-trifluoropentyl)-1H-pyrazole-5-sulfonamide |
| SMILES | O=S(=O)(NCCCCC(F)(F)F)c1ccn[nH]1 |
| InChI | InChI=1S/C8H12F3N3O2S/c9-8(10,11)4-1-2-5-13-17(15,16)7-3-6-12-14-7/h3,6,13H,1-2,4-5H2,(H,12,14) |
| InChIKey | IXTAJCBBBDVTTN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|