C12H20N4O4S — CID 102692301
N-(3-hydroxypropyl)-1-(1H-pyrazol-5-ylsulfonyl)piperidine-4-carboxamide (PubChem CID 102692301) has the molecular formula C12H20N4O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-1-(1H-pyrazol-5-ylsulfonyl)piperidine-4-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-1-(1H-pyrazol-5-ylsulfonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 102692301 |
| Molecular Formula | C12H20N4O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-(3-hydroxypropyl)-1-(1H-pyrazol-5-ylsulfonyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCO)C1CCN(S(=O)(=O)c2ccn[nH]2)CC1 |
| InChI | InChI=1S/C12H20N4O4S/c17-9-1-5-13-12(18)10-3-7-16(8-4-10)21(19,20)11-2-6-14-15-11/h2,6,10,17H,1,3-5,7-9H2,(H,13,18)(H,14,15) |
| InChIKey | AMDRPTVVHNFJCG-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|