C12H21N5O3S2 — CID 122154844
N-(3-methylsulfanylpropyl)-4-(1H-pyrazol-5-ylsulfonyl)piperazine-1-carboxamide (PubChem CID 122154844) has the molecular formula C12H21N5O3S2 and a molecular weight of 347.47 g/mol. Its IUPAC name is N-(3-methylsulfanylpropyl)-4-(1H-pyrazol-5-ylsulfonyl)piperazine-1-carboxamide.
| Compound Name | N-(3-methylsulfanylpropyl)-4-(1H-pyrazol-5-ylsulfonyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 122154844 |
| Molecular Formula | C12H21N5O3S2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-(3-methylsulfanylpropyl)-4-(1H-pyrazol-5-ylsulfonyl)piperazine-1-carboxamide |
| SMILES | CSCCCNC(=O)N1CCN(S(=O)(=O)c2ccn[nH]2)CC1 |
| InChI | InChI=1S/C12H21N5O3S2/c1-21-10-2-4-13-12(18)16-6-8-17(9-7-16)22(19,20)11-3-5-14-15-11/h3,5H,2,4,6-10H2,1H3,(H,13,18)(H,14,15) |
| InChIKey | XGMSPPWCXMUGQM-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|