C16H21N3O4S — CID 10269393
(3R,4S)-N-hydroxy-3-(isoquinolin-1-ylsulfonylamino)-4-methylhexanamide (PubChem CID 10269393) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is (3R,4S)-N-hydroxy-3-(isoquinolin-1-ylsulfonylamino)-4-methylhexanamide.
| Compound Name | (3R,4S)-N-hydroxy-3-(isoquinolin-1-ylsulfonylamino)-4-methylhexanamide |
|---|---|
| PubChem CID | 10269393 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (3R,4S)-N-hydroxy-3-(isoquinolin-1-ylsulfonylamino)-4-methylhexanamide |
| SMILES | CC[C@H](C)[C@@H](CC(=O)NO)NS(=O)(=O)c1nccc2ccccc12 |
| InChI | InChI=1S/C16H21N3O4S/c1-3-11(2)14(10-15(20)18-21)19-24(22,23)16-13-7-5-4-6-12(13)8-9-17-16/h4-9,11,14,19,21H,3,10H2,1-2H3,(H,18,20)/t11-,14+/m0/s1 |
| InChIKey | KLJJDTDJUIEFHW-SMDDNHRTSA-N |
| XLogP | 1.82 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|