C17H22N2O4S — CID 10291533
(4S)-N-hydroxy-4-methyl-3-(naphthalen-1-ylsulfonylamino)hexanamide (PubChem CID 10291533) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is (4S)-N-hydroxy-4-methyl-3-(naphthalen-1-ylsulfonylamino)hexanamide.
| Compound Name | (4S)-N-hydroxy-4-methyl-3-(naphthalen-1-ylsulfonylamino)hexanamide |
|---|---|
| PubChem CID | 10291533 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (4S)-N-hydroxy-4-methyl-3-(naphthalen-1-ylsulfonylamino)hexanamide |
| SMILES | CC[C@H](C)C(CC(=O)NO)NS(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H22N2O4S/c1-3-12(2)15(11-17(20)18-21)19-24(22,23)16-10-6-8-13-7-4-5-9-14(13)16/h4-10,12,15,19,21H,3,11H2,1-2H3,(H,18,20)/t12-,15?/m0/s1 |
| InChIKey | CADIUJZLECCREJ-SFVWDYPZSA-N |
| XLogP | 2.43 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|