C23H26N2O3S — CID 42706133
N-benzyl-3-methyl-2-(naphthalen-1-ylsulfonylamino)pentanamide (PubChem CID 42706133) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is N-benzyl-3-methyl-2-(naphthalen-1-ylsulfonylamino)pentanamide.
| Compound Name | N-benzyl-3-methyl-2-(naphthalen-1-ylsulfonylamino)pentanamide |
|---|---|
| PubChem CID | 42706133 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | N-benzyl-3-methyl-2-(naphthalen-1-ylsulfonylamino)pentanamide |
| SMILES | CCC(C)C(NS(=O)(=O)c1cccc2ccccc12)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H26N2O3S/c1-3-17(2)22(23(26)24-16-18-10-5-4-6-11-18)25-29(27,28)21-15-9-13-19-12-7-8-14-20(19)21/h4-15,17,22,25H,3,16H2,1-2H3,(H,24,26) |
| InChIKey | KNHMDDZGPVSLDK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |